cas: 33513-44-9 — see every product listed under this CAS number, including other names
Sodium 4-formylbenzene-1,3-disulfonate 98% (CAS 33513-44-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A158430-5g |
| cas | 33513-44-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 100g | 203.50 Pln | |
| Ambeed | 500g | 570.62 Pln | |
| Ambeed | 1000g | 1010.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A158430 |
Disodium;4-formylbenzene-1,3-disulfonate (CAS 33513-44-9) is a chemical compound with the molecular formula C7H4Na2O7S2 and a molecular weight of 310.2 g/mol. IUPAC name: disodium;4-formylbenzene-1,3-disulfonate. InChIKey: UUKHCUPMVISNFW-UHFFFAOYSA-L.
| Molecular formula | C7H4Na2O7S2 |
|---|---|
| Molecular weight | 310.2 g/mol |
| IUPAC name | disodium;4-formylbenzene-1,3-disulfonate |
| InChIKey | UUKHCUPMVISNFW-UHFFFAOYSA-L |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)[O-])S(=O)(=O)[O-])C=O.[Na+].[Na+] |
Computed by PubChem (NCBI)