cas: 33513-44-9 — see every product listed under this CAS number, including other names
Sodium 4-formylbenzene-1,3-disulfonate, 95% (CAS 33513-44-9) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F243115-500G |
| cas | 33513-44-9 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500g | 414.46 Pln | |
| Fluorochem | 1kg | 778.91 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Disodium;4-formylbenzene-1,3-disulfonate (CAS 33513-44-9) is a chemical compound with the molecular formula C7H4Na2O7S2 and a molecular weight of 310.2 g/mol. IUPAC name: disodium;4-formylbenzene-1,3-disulfonate. InChIKey: UUKHCUPMVISNFW-UHFFFAOYSA-L.
| Molecular formula | C7H4Na2O7S2 |
|---|---|
| Molecular weight | 310.2 g/mol |
| IUPAC name | disodium;4-formylbenzene-1,3-disulfonate |
| InChIKey | UUKHCUPMVISNFW-UHFFFAOYSA-L |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)[O-])S(=O)(=O)[O-])C=O.[Na+].[Na+] |
Computed by PubChem (NCBI)