Sodium 4-methyl-2-oxopentanoate, 95%, 95%
cas: 4502-00-5 — see every product listed under this CAS number, including other names
Sodium 4-methyl-2-oxopentanoate, 95%, 95% (CAS 4502-00-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1146LA-100mg |
| cas | 4502-00-5 |
| size | 100mg |
| availability | 500g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 184.40 Pln | |
| Chemat | 5g | 366.80 Pln | |
| Chemat | 10g | 496.40 Pln | |
| Chemat | 25g | 933.20 Pln | |
| Chemat | 100g | 2680.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Sodium 4-methyl-2-oxopentanoate (CAS 4502-00-5) is a chemical compound with the molecular formula C6H9NaO3 and a molecular weight of 152.12 g/mol. IUPAC name: sodium 4-methyl-2-oxopentanoate. InChIKey: IXFAZKRLPPMQEO-UHFFFAOYSA-M.
| Molecular formula | C6H9NaO3 |
|---|---|
| Molecular weight | 152.12 g/mol |
| IUPAC name | sodium 4-methyl-2-oxopentanoate |
| InChIKey | IXFAZKRLPPMQEO-UHFFFAOYSA-M |
| SMILES | CC(C)CC(=O)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)
Synonyms:
sodium 4-methyl-2-oxopentanoate, Sodium 4-methyl-2-oxovalerate, Sodium alpha-ketoisocaproate, Sodium ketoisocaproate, Ketoleucine sodium salt, 4-Methyl-2-oxovaleric acid sodium salt, 4-Methyl-2-oxopentanoic acid sodium salt, Sodium 2-Ketoisocaproate, Sodium |A-Ketoisocaproate, sodium;4-methyl-2-oxopentanoate