CAS 4502-00-5 appears in our catalog under these names: 4–methyl–2–Oxovalerate (sodium salt), 4-Methyl-2-oxopentanoic acid sodium salt, 97%, 4-Methyl-2-oxovaleric Acid Sodium Salt, >95% (HPLC), 4-methyl-2-Oxovalerate (sodium salt), Sodium alpha-ketoisocaproate. Offered by: GLPBio, Combi-blocks, TRC, TargetMol, Biosynth. Available pack sizes: 5g, 25g, 100g, 1g, 500mg, 10g, 50g, 100mg.
Sodium 4-methyl-2-oxopentanoate (CAS 4502-00-5) is a chemical compound with the molecular formula C6H9NaO3 and a molecular weight of 152.12 g/mol. IUPAC name: sodium 4-methyl-2-oxopentanoate. InChIKey: IXFAZKRLPPMQEO-UHFFFAOYSA-M.
| Molecular formula | C6H9NaO3 |
|---|---|
| Molecular weight | 152.12 g/mol |
| IUPAC name | sodium 4-methyl-2-oxopentanoate |
| InChIKey | IXFAZKRLPPMQEO-UHFFFAOYSA-M |
| SMILES | CC(C)CC(=O)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)