Sodium 6-chloropyridine-2-sulfinate, 95%
cas: 2682112-92-9 — see every product listed under this CAS number, including other names
Sodium 6-chloropyridine-2-sulfinate, 95% (CAS 2682112-92-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, BLDpharm, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F547114-100MG |
| cas | 2682112-92-9 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 700.81 Pln | |
| Fluorochem | 250mg | 997.58 Pln | |
| Fluorochem | 1g | 2361.69 Pln | |
| Ambeed | 250mg | 654.06 Pln | |
| Ambeed | 1g | 1482.88 Pln | |
| Ambeed | 5g | 5727.06 Pln | |
| BLDpharm | 100mg | 486.52 Pln | |
| BLDpharm | 250mg | 697.56 Pln | |
| BLDpharm | 1g | 1591.69 Pln | |
| BLDpharm | 5g | 6167.85 Pln | |
| Chemat | 100mg | 482.00 Pln | |
| Chemat | 250mg | 693.20 Pln | |
| Chemat | 1g | 1638.80 Pln | |
| Chemat | 5g | 6362.00 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
Sodium 6-chloropyridine-2-sulfinate (CAS 2682112-92-9) is a chemical compound with the molecular formula C5H3ClNNaO2S and a molecular weight of 199.59 g/mol. IUPAC name: sodium 6-chloropyridine-2-sulfinate. InChIKey: PURIHCUDCCTCIH-UHFFFAOYSA-M.
| Molecular formula | C5H3ClNNaO2S |
|---|---|
| Molecular weight | 199.59 g/mol |
| IUPAC name | sodium 6-chloropyridine-2-sulfinate |
| InChIKey | PURIHCUDCCTCIH-UHFFFAOYSA-M |
| SMILES | C1=CC(=NC(=C1)Cl)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)