CAS 1803610-24-3 is the registry number for Sodium 2-(5-chloro-1,3-thiazol-2-yl)acetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Sodium 2-(5-chloro-1,3-thiazol-2-yl)acetate (CAS 1803610-24-3) is a chemical compound with the molecular formula C5H3ClNNaO2S and a molecular weight of 199.59 g/mol. IUPAC name: sodium 2-(5-chloro-1,3-thiazol-2-yl)acetate. InChIKey: RGHMQUDZFCTFPI-UHFFFAOYSA-M.
| Molecular formula | C5H3ClNNaO2S |
|---|---|
| Molecular weight | 199.59 g/mol |
| IUPAC name | sodium 2-(5-chloro-1,3-thiazol-2-yl)acetate |
| InChIKey | RGHMQUDZFCTFPI-UHFFFAOYSA-M |
| SMILES | C1=C(SC(=N1)CC(=O)[O-])Cl.[Na+] |
Computed by PubChem (NCBI)