cas: 55310-46-8 — see every product listed under this CAS number, including other names
Sodium Dibenzyldithiocarbamate, >85.0%(T) (CAS 55310-46-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D0156-5G |
| cas | 55310-46-8 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 472.39 Pln | |
| TCI | 25g | 1706.62 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >85.0%(T) |
Sodium N,N-dibenzylcarbamodithioate (CAS 55310-46-8) is a chemical compound with the molecular formula C15H14NNaS2 and a molecular weight of 295.4 g/mol. IUPAC name: sodium N,N-dibenzylcarbamodithioate. InChIKey: MYCPTMLDBVIIES-UHFFFAOYSA-M.
| Molecular formula | C15H14NNaS2 |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | sodium N,N-dibenzylcarbamodithioate |
| InChIKey | MYCPTMLDBVIIES-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)CN(CC2=CC=CC=C2)C(=S)[S-].[Na+] |
Computed by PubChem (NCBI)