CAS 55310-46-8 appears in our catalog under these names: Dibenzyldithiocarbamic acid sodium salt hydrate, 95%, Dibenzyldithiocarbamic acid sodium salt, 98%, Sodium Dibenzyldithiocarbamate Hydrate, Sodium dibenzyldithiocarbamate hydrate, Sodium Dibenzyldithiocarbamate, >85.0%(T). Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 5g, 25g, 1g, 10g, 50g, 100g, 100mg, 250mg.
Sodium N,N-dibenzylcarbamodithioate (CAS 55310-46-8) is a chemical compound with the molecular formula C15H14NNaS2 and a molecular weight of 295.4 g/mol. IUPAC name: sodium N,N-dibenzylcarbamodithioate. InChIKey: MYCPTMLDBVIIES-UHFFFAOYSA-M.
| Molecular formula | C15H14NNaS2 |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | sodium N,N-dibenzylcarbamodithioate |
| InChIKey | MYCPTMLDBVIIES-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)CN(CC2=CC=CC=C2)C(=S)[S-].[Na+] |
Computed by PubChem (NCBI)