cas: 822-17-3 — see every product listed under this CAS number, including other names
Sodium Linoleate, 98%, 98% (CAS 822-17-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119L9G-1g |
| cas | 822-17-3 |
| size | 1g |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 122.00 Pln | |
| Chemat | 25g | 1720.40 Pln | |
| Chemat | 250mg | 88.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Sodium (9Z,12Z)-octadeca-9,12-dienoate (CAS 822-17-3) is a chemical compound with the molecular formula C18H31NaO2 and a molecular weight of 302.4 g/mol. IUPAC name: sodium (9Z,12Z)-octadeca-9,12-dienoate. InChIKey: WYPBVHPKMJYUEO-NBTZWHCOSA-M.
| Molecular formula | C18H31NaO2 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | sodium (9Z,12Z)-octadeca-9,12-dienoate |
| InChIKey | WYPBVHPKMJYUEO-NBTZWHCOSA-M |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)