CAS 822-17-3 appears in our catalog under these names: Linoleic acid sodium salt, 98%, Linoleic Acid (sodium salt), Sodium linoleate, Sodium Linoleate, >95.0%(T), Sodium Linoleate, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 25g, 1g, 5g, 100g, 100mg, 500mg, 10g, 50g.
Sodium (9Z,12Z)-octadeca-9,12-dienoate (CAS 822-17-3) is a chemical compound with the molecular formula C18H31NaO2 and a molecular weight of 302.4 g/mol. IUPAC name: sodium (9Z,12Z)-octadeca-9,12-dienoate. InChIKey: WYPBVHPKMJYUEO-NBTZWHCOSA-M.
| Molecular formula | C18H31NaO2 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | sodium (9Z,12Z)-octadeca-9,12-dienoate |
| InChIKey | WYPBVHPKMJYUEO-NBTZWHCOSA-M |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)