cas: 538-42-1 — see every product listed under this CAS number, including other names
Sodium cinnamate, 99%, 99% (CAS 538-42-1) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g, 2.5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0LO-100g |
| cas | 538-42-1 |
| size | 100g |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 98.00 Pln | |
| Chemat | 500g | 225.60 Pln | |
| Chemat | 2.5kg | 660.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
Sodium (E)-3-phenylprop-2-enoate (CAS 538-42-1) is a chemical compound with the molecular formula C9H7NaO2 and a molecular weight of 170.14 g/mol. IUPAC name: sodium (E)-3-phenylprop-2-enoate. InChIKey: DXIHILNWDOYYCH-UHDJGPCESA-M.
| Molecular formula | C9H7NaO2 |
|---|---|
| Molecular weight | 170.14 g/mol |
| IUPAC name | sodium (E)-3-phenylprop-2-enoate |
| InChIKey | DXIHILNWDOYYCH-UHDJGPCESA-M |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)