CAS 538-42-1 appears in our catalog under these names: Sodium cinnamate, 98%, 2-(1,3-Dioxo-1,3-dihydro-isoindol-2-yl)-benzoic Acid, >95% (HPLC), Cinnamic acid,sodium salt, Sodium cinnamate, Sodium cinnamate, 99%, 99%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 25g, 5g, 100g, 1g, 500mg, 500g, 10g, 50g.
Sodium (E)-3-phenylprop-2-enoate (CAS 538-42-1) is a chemical compound with the molecular formula C9H7NaO2 and a molecular weight of 170.14 g/mol. IUPAC name: sodium (E)-3-phenylprop-2-enoate. InChIKey: DXIHILNWDOYYCH-UHDJGPCESA-M.
| Molecular formula | C9H7NaO2 |
|---|---|
| Molecular weight | 170.14 g/mol |
| IUPAC name | sodium (E)-3-phenylprop-2-enoate |
| InChIKey | DXIHILNWDOYYCH-UHDJGPCESA-M |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)