Sodium oxazole-2-carboxylate, 97%
cas: 1255098-88-4 — see every product listed under this CAS number, including other names
Sodium oxazole-2-carboxylate, 97% (CAS 1255098-88-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg, 25g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F049914-250MG |
| cas | 1255098-88-4 |
| size | 250mg |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 544.62 Pln | |
| Fluorochem | 5g | 1762.94 Pln | |
| Fluorochem | 10g | 3429.02 Pln | |
| Ambeed | 100mg | 236.88 Pln | |
| Ambeed | 250mg | 275.81 Pln | |
| Ambeed | 1g | 548.38 Pln | |
| Ambeed | 5g | 1727.62 Pln | |
| Ambeed | 10g | 3374.12 Pln | |
| Ambeed | 25g | 6667.12 Pln | |
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 419.60 Pln | |
| Chemat | 5g | 1230.80 Pln | |
| Chemat | 10g | 2214.80 Pln | |
| Chemat | 25g | 4610.00 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
Sodium 1,3-oxazole-2-carboxylate (CAS 1255098-88-4) is a chemical compound with the molecular formula C4H2NNaO3 and a molecular weight of 135.05 g/mol. IUPAC name: sodium 1,3-oxazole-2-carboxylate. InChIKey: DAMOVWVGBYVXET-UHFFFAOYSA-M.
| Molecular formula | C4H2NNaO3 |
|---|---|
| Molecular weight | 135.05 g/mol |
| IUPAC name | sodium 1,3-oxazole-2-carboxylate |
| InChIKey | DAMOVWVGBYVXET-UHFFFAOYSA-M |
| SMILES | C1=COC(=N1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)