CAS 1255098-88-4 appears in our catalog under these names: Oxazole-2-carboxylic acid sodium salt, 96%, Sodium oxazole-2-carboxylate 97%, Sodium oxazole-2-carboxylate, 97%, 97%, Sodium oxazole-2-carboxylate, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 25g.
Sodium 1,3-oxazole-2-carboxylate (CAS 1255098-88-4) is a chemical compound with the molecular formula C4H2NNaO3 and a molecular weight of 135.05 g/mol. IUPAC name: sodium 1,3-oxazole-2-carboxylate. InChIKey: DAMOVWVGBYVXET-UHFFFAOYSA-M.
| Molecular formula | C4H2NNaO3 |
|---|---|
| Molecular weight | 135.05 g/mol |
| IUPAC name | sodium 1,3-oxazole-2-carboxylate |
| InChIKey | DAMOVWVGBYVXET-UHFFFAOYSA-M |
| SMILES | C1=COC(=N1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)