CAS 1415792-84-5 appears in our catalog under these names: Sovleplenib, Sovleplenib/ 98.51% (existing batch purity), Sovleplenib 95%, sovleplenib, 95%, 95%, Sovleplenib, 99.94%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 5g, 250mg.
7-[4-(1-methylsulfonylpiperidin-4-yl)phenyl]-N-[[(2S)-morpholin-2-yl]methyl]pyrido[3,4-b]pyrazin-5-amine (CAS 1415792-84-5) is a chemical compound with the molecular formula C24H30N6O3S and a molecular weight of 482.6 g/mol. IUPAC name: 7-[4-(1-methylsulfonylpiperidin-4-yl)phenyl]-N-[[(2S)-morpholin-2-yl]methyl]pyrido[3,4-b]pyrazin-5-amine. InChIKey: NJIAKNWTIVDSDA-FQEVSTJZSA-N.
| Molecular formula | C24H30N6O3S |
|---|---|
| Molecular weight | 482.6 g/mol |
| IUPAC name | 7-[4-(1-methylsulfonylpiperidin-4-yl)phenyl]-N-[[(2S)-morpholin-2-yl]methyl]pyrido[3,4-b]pyrazin-5-amine |
| InChIKey | NJIAKNWTIVDSDA-FQEVSTJZSA-N |
| SMILES | CS(=O)(=O)N1CCC(CC1)C2=CC=C(C=C2)C3=CC4=NC=CN=C4C(=N3)NC[C@@H]5CNCCO5 |
Computed by PubChem (NCBI)