cas: 16331-96-7 — see every product listed under this CAS number, including other names
Spiro[2h-1-benzopyran-2,2'-[2h]indole],1',3'-dihydro-5'-methoxy-1',3',3'-trimethyl-6-nitro-, 95%, 95% (CAS 16331-96-7) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112U1V-25mg |
| cas | 16331-96-7 |
| size | 25mg |
| availability | 0.32g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 371.60 Pln | |
| Chemat | 100mg | 1029.20 Pln | |
| Chemat | 250mg | 2406.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5'-methoxy-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] (CAS 16331-96-7) is a chemical compound with the molecular formula C20H20N2O4 and a molecular weight of 352.4 g/mol. IUPAC name: 5'-methoxy-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole]. InChIKey: YPVXHRMUYMHMIT-UHFFFAOYSA-N.
| Molecular formula | C20H20N2O4 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | 5'-methoxy-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
| InChIKey | YPVXHRMUYMHMIT-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)OC)N(C13C=CC4=C(O3)C=CC(=C4)[N+](=O)[O-])C)C |
Computed by PubChem (NCBI)