Spiro[fluorene-9,9'-xanthen]-2'-ylboronic acid, 95%
cas: 2396648-06-7 — see every product listed under this CAS number, including other names
Spiro[fluorene-9,9'-xanthen]-2'-ylboronic acid, 95% (CAS 2396648-06-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1212418-250mg |
| cas | 2396648-06-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 776.44 Pln | |
| Ambeed | 1g | 1961.25 Pln | |
| Ambeed | 5g | 6683.81 Pln | |
| Ambeed | 10g | 10649.88 Pln | |
| Chemat | 100mg | 482.00 Pln | |
| Chemat | 250mg | 774.80 Pln | |
| Chemat | 1g | 1984.40 Pln | |
| Chemat | 5g | 6779.60 Pln | |
| Chemat | 10g | 10806.80 Pln | |
| BLDpharm | 100mg | 469.86 Pln | |
| BLDpharm | 250mg | 741.99 Pln | |
| BLDpharm | 1g | 1886.03 Pln | |
| BLDpharm | 5g | 6434.43 Pln | |
| BLDpharm | 10g | 10255.30 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Spiro[fluorene-9,9'-xanthene]-2'-ylboronic acid (CAS 2396648-06-7) is a chemical compound with the molecular formula C25H17BO3 and a molecular weight of 376.2 g/mol. IUPAC name: spiro[fluorene-9,9'-xanthene]-2'-ylboronic acid. InChIKey: XWJYQPFDUBPRKM-UHFFFAOYSA-N.
| Molecular formula | C25H17BO3 |
|---|---|
| Molecular weight | 376.2 g/mol |
| IUPAC name | spiro[fluorene-9,9'-xanthene]-2'-ylboronic acid |
| InChIKey | XWJYQPFDUBPRKM-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)OC3=CC=CC=C3C24C5=CC=CC=C5C6=CC=CC=C46)(O)O |
Computed by PubChem (NCBI)
Synonyms:
Spiro[fluorene-9,9'-xanthen]-2'-ylboronic acid, Boronic acid, B-spiro[9H-fluorene-9,9'-[9H]xanthen]-2'-yl-, Fluoren-9,9' -xanthine] -2' -yl boric acid, Spiro[fluorene-9,9'-xanthen]-2'-ylboronicacid, Spiro[fluorene-9,9'-xanthine]-2'-ylboronic acid, B-spiro[9H-fluorene-9,9'-[9h]xanthen]-2'-ylboronic acid