CAS 2244281-69-2 appears in our catalog under these names: Spiro[fluorene-9,9'-xanthen]-4-ylboronic acid, 98% (contains~7.0%DCM), 98% (contains~7.0%DCM), Spiro[fluorene-9,9'-xanthen]-4-ylboronic acid, 98% (contains~7.0%DCM). Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g.
Spiro[fluorene-9,9'-xanthene]-4-ylboronic acid (CAS 2244281-69-2) is a chemical compound with the molecular formula C25H17BO3 and a molecular weight of 376.2 g/mol. IUPAC name: spiro[fluorene-9,9'-xanthene]-4-ylboronic acid. InChIKey: HWHPWSGSPMRPLT-UHFFFAOYSA-N.
| Molecular formula | C25H17BO3 |
|---|---|
| Molecular weight | 376.2 g/mol |
| IUPAC name | spiro[fluorene-9,9'-xanthene]-4-ylboronic acid |
| InChIKey | HWHPWSGSPMRPLT-UHFFFAOYSA-N |
| SMILES | B(C1=C2C3=CC=CC=C3C4(C2=CC=C1)C5=CC=CC=C5OC6=CC=CC=C46)(O)O |
Computed by PubChem (NCBI)