CAS 2582757-90-0 appears in our catalog under these names: Stafia–1, Stafia-1/ 98.15% (existing batch purity), 3,3'',4,4'',5,5''-Hexamethoxy-[1,1':3',1''-terphenyl]-5'-yl dihydrogen phosphate, 95%, 95%, Stafia-1, 99.39%, Stafia-1, 98%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress, Ambeed. Available pack sizes: 10mg, 100mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 1mg, 500mg.
[3,5-bis(3,4,5-trimethoxyphenyl)phenyl] dihydrogen phosphate (CAS 2582757-90-0) is a chemical compound with the molecular formula C24H27O10P and a molecular weight of 506.4 g/mol. IUPAC name: [3,5-bis(3,4,5-trimethoxyphenyl)phenyl] dihydrogen phosphate. InChIKey: UGUOUFLCZFMHNI-UHFFFAOYSA-N.
| Molecular formula | C24H27O10P |
|---|---|
| Molecular weight | 506.4 g/mol |
| IUPAC name | [3,5-bis(3,4,5-trimethoxyphenyl)phenyl] dihydrogen phosphate |
| InChIKey | UGUOUFLCZFMHNI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C2=CC(=CC(=C2)OP(=O)(O)O)C3=CC(=C(C(=C3)OC)OC)OC |
Computed by PubChem (NCBI)