CAS 317337-07-8 appears in our catalog under these names: 4–(4–(5–Mercapto–1,3,4– oxadiazol–2–yl)phenyl) thiosemicarbazide, Stemazole/ 98.17% (existing batch purity), Stemazole, N-(4-(5-Mercapto-1,3,4-oxadiazol-2-yl)phenyl)hydrazinecarbothioamide, 98%, 98%, Stemazole, 99.96%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
1-amino-3-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]thiourea (CAS 317337-07-8) is a chemical compound with the molecular formula C9H9N5OS2 and a molecular weight of 267.3 g/mol. IUPAC name: 1-amino-3-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]thiourea. InChIKey: DSZWZHYEFYRNQI-UHFFFAOYSA-N.
| Molecular formula | C9H9N5OS2 |
|---|---|
| Molecular weight | 267.3 g/mol |
| IUPAC name | 1-amino-3-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]thiourea |
| InChIKey | DSZWZHYEFYRNQI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=S)O2)NC(=S)NN |
Computed by PubChem (NCBI)