cas: 471-80-7 — see every product listed under this CAS number, including other names
Steviol 95% (CAS 471-80-7) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A121554-1mg |
| cas | 471-80-7 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 214.62 Pln | |
| Ambeed | 5mg | 414.88 Pln | |
| Ambeed | 10mg | 581.75 Pln | |
| Ambeed | 50mg | 854.31 Pln | |
| Ambeed | 100mg | 1393.88 Pln | |
| Ambeed | 250mg | 2311.69 Pln | |
| Ambeed | 1g | 6122.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A121554 |
(1R,4S,5R,9S,10R,13S)-13-hydroxy-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid (CAS 471-80-7) is a chemical compound with the molecular formula C20H30O3 and a molecular weight of 318.4 g/mol. IUPAC name: (1R,4S,5R,9S,10R,13S)-13-hydroxy-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid. InChIKey: QFVOYBUQQBFCRH-VQSWZGCSSA-N.
| Molecular formula | C20H30O3 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | (1R,4S,5R,9S,10R,13S)-13-hydroxy-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid |
| InChIKey | QFVOYBUQQBFCRH-VQSWZGCSSA-N |
| SMILES | C[C@@]12CCC[C@@]([C@H]1CC[C@]34[C@H]2CC[C@](C3)(C(=C)C4)O)(C)C(=O)O |
Computed by PubChem (NCBI)