CAS 131339-24-7 appears in our catalog under these names: (5Z,8Z,11Z)-13-((2S,3R)-3-((Z)-Pent-2-en-1-yl)oxiran-2-yl)trideca-5,8,11-trienoic acid, 97%, (±)14(15)-EpETE, (±)14(15)–EpETE, 14(15)-EpETE. Offered by: Chemat Brand, TargetMol, GLPBio, MedChemExpress. Available pack sizes: on request, 25ug, 50ug, 100ug, 500ug, 100μg, 25μg, 50μg.
(5Z,8Z,11Z)-13-[(2S,3R)-3-[(Z)-pent-2-enyl]oxiran-2-yl]trideca-5,8,11-trienoic acid (CAS 131339-24-7) is a chemical compound with the molecular formula C20H30O3 and a molecular weight of 318.4 g/mol. IUPAC name: (5Z,8Z,11Z)-13-[(2S,3R)-3-[(Z)-pent-2-enyl]oxiran-2-yl]trideca-5,8,11-trienoic acid. InChIKey: RGZIXZYRGZWDMI-IXQKDQKQSA-N.
| Molecular formula | C20H30O3 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | (5Z,8Z,11Z)-13-[(2S,3R)-3-[(Z)-pent-2-enyl]oxiran-2-yl]trideca-5,8,11-trienoic acid |
| InChIKey | RGZIXZYRGZWDMI-IXQKDQKQSA-N |
| SMILES | CC/C=C\C[C@@H]1[C@@H](O1)C/C=C\C/C=C\C/C=C\CCCC(=O)O |
Computed by PubChem (NCBI)