CAS 216167-82-7 appears in our catalog under these names: Succinobucol/ 98.8% (existing batch purity), Succinobucol (AGI–1067), Succinobucol, Succinobucol 99%, Succinobucol, 99.62%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso), 1mg.
4-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]-4-oxobutanoic acid (CAS 216167-82-7) is a chemical compound with the molecular formula C35H52O5S2 and a molecular weight of 616.9 g/mol. IUPAC name: 4-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]-4-oxobutanoic acid. InChIKey: RKSMVPNZHBRNNS-UHFFFAOYSA-N.
| Molecular formula | C35H52O5S2 |
|---|---|
| Molecular weight | 616.9 g/mol |
| IUPAC name | 4-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]-4-oxobutanoic acid |
| InChIKey | RKSMVPNZHBRNNS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)SC(C)(C)SC2=CC(=C(C(=C2)C(C)(C)C)OC(=O)CCC(=O)O)C(C)(C)C |
Computed by PubChem (NCBI)