CAS 547-32-0 appears in our catalog under these names: Sulfadiazine Sodium Salt, Sulfadiazine sodium/ 99.64% (existing batch purity), Sulfadiazine sodium salt, 99.00%, Sulfadiazine sodium, Sulfadiazine Sodium, >98.0%(HPLC)(T). Offered by: Chemat Brand, TRC, TargetMol, Chemat, Biosynth. Available pack sizes: on request, 25g, 50g, 1g, 5g, 100g, 1mg, 25mg.
Sodium (4-aminophenyl)sulfonyl-pyrimidin-2-ylazanide (CAS 547-32-0) is a chemical compound with the molecular formula C10H9N4NaO2S and a molecular weight of 272.26 g/mol. IUPAC name: sodium (4-aminophenyl)sulfonyl-pyrimidin-2-ylazanide. InChIKey: JLDCNMJPBBKAHH-UHFFFAOYSA-N.
| Molecular formula | C10H9N4NaO2S |
|---|---|
| Molecular weight | 272.26 g/mol |
| IUPAC name | sodium (4-aminophenyl)sulfonyl-pyrimidin-2-ylazanide |
| InChIKey | JLDCNMJPBBKAHH-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)[N-]S(=O)(=O)C2=CC=C(C=C2)N.[Na+] |
Computed by PubChem (NCBI)