cas: 1310949-97-3 — see every product listed under this CAS number, including other names
Sulfamide, N,N-dimethyl-N'-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-, 95%, 95% (CAS 1310949-97-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11SO7L-250mg |
| cas | 1310949-97-3 |
| size | 250mg |
| availability | 8.6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 957.20 Pln | |
| Chemat | 1g | 2819.60 Pln | |
| Chemat | 5g | 8334.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[4-(dimethylsulfamoylamino)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1310949-97-3) is a chemical compound with the molecular formula C14H23BN2O4S and a molecular weight of 326.2 g/mol. IUPAC name: 2-[4-(dimethylsulfamoylamino)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: WVHNVROSLBGKJA-UHFFFAOYSA-N.
| Molecular formula | C14H23BN2O4S |
|---|---|
| Molecular weight | 326.2 g/mol |
| IUPAC name | 2-[4-(dimethylsulfamoylamino)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | WVHNVROSLBGKJA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NS(=O)(=O)N(C)C |
Computed by PubChem (NCBI)