CAS 2377609-49-7 is the registry number for 5-(4-BOC-Piperazinomethyl)thiophene-2-boronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[5-[[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]methyl]thiophen-2-yl]boronic acid (CAS 2377609-49-7) is a chemical compound with the molecular formula C14H23BN2O4S and a molecular weight of 326.2 g/mol. IUPAC name: [5-[[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]methyl]thiophen-2-yl]boronic acid. InChIKey: BFMOFEGNZBELOU-UHFFFAOYSA-N.
| Molecular formula | C14H23BN2O4S |
|---|---|
| Molecular weight | 326.2 g/mol |
| IUPAC name | [5-[[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]methyl]thiophen-2-yl]boronic acid |
| InChIKey | BFMOFEGNZBELOU-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(S1)CN2CCN(CC2)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)