CAS 1308672-74-3 appears in our catalog under these names: Sulfatinib/ 98.93% (existing batch purity), Sulfatinib (HMPL–012), Sulfatinib 99+%, Sulfatinib, 99.52%, Sulfatinib (Standard). Offered by: TargetMol, GLPBio, Ambeed, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg.
N-[2-(dimethylamino)ethyl]-1-[3-[[4-[(2-methyl-1H-indol-5-yl)oxy]pyrimidin-2-yl]amino]phenyl]methanesulfonamide (CAS 1308672-74-3) is a chemical compound with the molecular formula C24H28N6O3S and a molecular weight of 480.6 g/mol. IUPAC name: N-[2-(dimethylamino)ethyl]-1-[3-[[4-[(2-methyl-1H-indol-5-yl)oxy]pyrimidin-2-yl]amino]phenyl]methanesulfonamide. InChIKey: TTZSNFLLYPYKIL-UHFFFAOYSA-N.
| Molecular formula | C24H28N6O3S |
|---|---|
| Molecular weight | 480.6 g/mol |
| IUPAC name | N-[2-(dimethylamino)ethyl]-1-[3-[[4-[(2-methyl-1H-indol-5-yl)oxy]pyrimidin-2-yl]amino]phenyl]methanesulfonamide |
| InChIKey | TTZSNFLLYPYKIL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1)C=CC(=C2)OC3=NC(=NC=C3)NC4=CC=CC(=C4)CS(=O)(=O)NCCN(C)C |
Computed by PubChem (NCBI)