CAS 1321-14-8 appears in our catalog under these names: Sulfogaiacol/ 99.66% (existing batch purity), Sulfogaiacol, Gualicol sulfonic acid potassium salt, Potassium guaiacolsulfonate, 98%+,RG, 98%+,RG, Sulfogaiacol, 99.88%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1g, 10mM (in 1ml dmso), 0,1kg, 0,25kg, 0,5kg, 2kg, 1kg, 2.5kg.
Potassium;4-hydroxy-3-methoxybenzenesulfonate;hydrate (CAS 1321-14-8) is a chemical compound with the molecular formula C7H9KO6S and a molecular weight of 260.31 g/mol. IUPAC name: potassium;4-hydroxy-3-methoxybenzenesulfonate;hydrate. InChIKey: UZXRQGSKGNYWCP-UHFFFAOYSA-M.
| Molecular formula | C7H9KO6S |
|---|---|
| Molecular weight | 260.31 g/mol |
| IUPAC name | potassium;4-hydroxy-3-methoxybenzenesulfonate;hydrate |
| InChIKey | UZXRQGSKGNYWCP-UHFFFAOYSA-M |
| SMILES | COC1=C(C=CC(=C1)S(=O)(=O)[O-])O.O.[K+] |
Computed by PubChem (NCBI)