Suprafenacine
cas: 1477482-50-0 — see every product listed under this CAS number, including other names
Suprafenacine (CAS 1477482-50-0) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg. Offered by: TargetMol, GLPBio, Chemat.
| brand | TargetMol |
|---|---|
| catalog number | T28886-1mg |
| cas | 1477482-50-0 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 565.03 Pln | |
| TargetMol | 2mg | 711.49 Pln | |
| TargetMol | 5mg | 1036.82 Pln | |
| TargetMol | 10mg | 1382.29 Pln | |
| TargetMol | 25mg | 2331.47 Pln | |
| TargetMol | 50mg | 3195.12 Pln | |
| TargetMol | 100mg | 4436.66 Pln | |
| TargetMol | 200mg | 5798.39 Pln | |
| GLPBio | 1mg | 615.76 Pln | |
| GLPBio | 10mg | 1725.04 Pln | |
| GLPBio | 5mg | 1116.58 Pln | |
| Chemat | 2mg | 568.40 Pln | |
| Chemat | 200mg | 4979.60 Pln | |
| Chemat | 1mg | 280.40 Pln | |
| Chemat | 5mg | 515.60 Pln | |
| Chemat | 10mg | 726.80 Pln | |
| Chemat | 25mg | 1178.00 Pln | |
| Chemat | 50mg | 1653.20 Pln | |
| Chemat | 100mg | 2243.60 Pln |
properties
| purity | No data |
|---|---|
| delivery time | approx. 15 days |
N-[(E)-(4-methylphenyl)methylideneamino]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide (CAS 1477482-50-0) is a chemical compound with the molecular formula C16H18N4O and a molecular weight of 282.34 g/mol. IUPAC name: N-[(E)-(4-methylphenyl)methylideneamino]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide. InChIKey: WKKLZIQHOXPLLZ-LICLKQGHSA-N.
| Molecular formula | C16H18N4O |
|---|---|
| Molecular weight | 282.34 g/mol |
| IUPAC name | N-[(E)-(4-methylphenyl)methylideneamino]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
| InChIKey | WKKLZIQHOXPLLZ-LICLKQGHSA-N |
| SMILES | CC1=CC=C(C=C1)/C=N/NC(=O)C2=NNC3=C2CCCC3 |
Computed by PubChem (NCBI)