CAS 5256-61-1 is the registry number for Lysergic Acid Hydrazide. Offered by: TRC, Biosynth. Available pack sizes: 25mg.
(6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carbohydrazide (CAS 5256-61-1) is a chemical compound with the molecular formula C16H18N4O and a molecular weight of 282.34 g/mol. IUPAC name: (6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carbohydrazide. InChIKey: UUYMPWWTAQZUQB-QMTHXVAHSA-N.
| Molecular formula | C16H18N4O |
|---|---|
| Molecular weight | 282.34 g/mol |
| IUPAC name | (6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carbohydrazide |
| InChIKey | UUYMPWWTAQZUQB-QMTHXVAHSA-N |
| SMILES | CN1C[C@@H](C=C2[C@H]1CC3=CNC4=CC=CC2=C34)C(=O)NN |
Computed by PubChem (NCBI)