CAS 5424-37-3 appears in our catalog under these names: Surfen dihydrochloride/ 97.08% (existing batch purity), Surfen, Surfen (dihydrochloride), 99.93%. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 1mg, 100 mg, 5 mg, 50 mg.
1,3-bis(4-amino-2-methylquinolin-6-yl)urea;dihydrochloride (CAS 5424-37-3) is a chemical compound with the molecular formula C21H22Cl2N6O and a molecular weight of 445.3 g/mol. IUPAC name: 1,3-bis(4-amino-2-methylquinolin-6-yl)urea;dihydrochloride. InChIKey: GKQYGRWQCWWSHN-UHFFFAOYSA-N.
| Molecular formula | C21H22Cl2N6O |
|---|---|
| Molecular weight | 445.3 g/mol |
| IUPAC name | 1,3-bis(4-amino-2-methylquinolin-6-yl)urea;dihydrochloride |
| InChIKey | GKQYGRWQCWWSHN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=C(C=CC2=N1)NC(=O)NC3=CC4=C(C=C(N=C4C=C3)C)N)N.Cl.Cl |
Computed by PubChem (NCBI)