CAS 53813-83-5 appears in our catalog under these names: Suriclone/ 98.52% (existing batch purity), Suriclone. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1 mg, 10 mg.
[6-(7-chloro-1,8-naphthyridin-2-yl)-5-oxo-3,7-dihydro-2H-[1,4]dithiino[2,3-c]pyrrol-7-yl] 4-methylpiperazine-1-carboxylate (CAS 53813-83-5) is a chemical compound with the molecular formula C20H20ClN5O3S2 and a molecular weight of 478.0 g/mol. IUPAC name: [6-(7-chloro-1,8-naphthyridin-2-yl)-5-oxo-3,7-dihydro-2H-[1,4]dithiino[2,3-c]pyrrol-7-yl] 4-methylpiperazine-1-carboxylate. InChIKey: RMXOUBDDDQUBKD-UHFFFAOYSA-N.
| Molecular formula | C20H20ClN5O3S2 |
|---|---|
| Molecular weight | 478.0 g/mol |
| IUPAC name | [6-(7-chloro-1,8-naphthyridin-2-yl)-5-oxo-3,7-dihydro-2H-[1,4]dithiino[2,3-c]pyrrol-7-yl] 4-methylpiperazine-1-carboxylate |
| InChIKey | RMXOUBDDDQUBKD-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C(=O)OC2C3=C(C(=O)N2C4=NC5=C(C=C4)C=CC(=N5)Cl)SCCS3 |
Computed by PubChem (NCBI)