CAS 1380782-27-3 appears in our catalog under these names: T2AA/ 98.19% (existing batch purity), T2AA, T2AA hydrochloride, (S)-4-(4-(2-Amino-2-hydroxypropyl)-2,6-diiodophenoxy)phenol, 98%, 98%, T2AA, 99.04%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 100 mg, 25 mg, 10mM/1mL.
4-[4-[(2S)-2-amino-3-hydroxypropyl]-2,6-diiodophenoxy]phenol (CAS 1380782-27-3) is a chemical compound with the molecular formula C15H15I2NO3 and a molecular weight of 511.09 g/mol. IUPAC name: 4-[4-[(2S)-2-amino-3-hydroxypropyl]-2,6-diiodophenoxy]phenol. InChIKey: NKOSKXJRVWVXRI-JTQLQIEISA-N.
| Molecular formula | C15H15I2NO3 |
|---|---|
| Molecular weight | 511.09 g/mol |
| IUPAC name | 4-[4-[(2S)-2-amino-3-hydroxypropyl]-2,6-diiodophenoxy]phenol |
| InChIKey | NKOSKXJRVWVXRI-JTQLQIEISA-N |
| SMILES | C1=CC(=CC=C1O)OC2=C(C=C(C=C2I)C[C@@H](CO)N)I |
Computed by PubChem (NCBI)