CAS 891020-54-5 appears in our catalog under these names: T521/ 99.65% (existing batch purity), T521, T521, 99.73%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 1 mg.
4-(benzenesulfonyl)-5-ethylsulfonyl-2-(4-fluorophenyl)-1,3-oxazole (CAS 891020-54-5) is a chemical compound with the molecular formula C17H14FNO5S2 and a molecular weight of 395.4 g/mol. IUPAC name: 4-(benzenesulfonyl)-5-ethylsulfonyl-2-(4-fluorophenyl)-1,3-oxazole. InChIKey: MVTLATINKNLPEJ-UHFFFAOYSA-N.
| Molecular formula | C17H14FNO5S2 |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | 4-(benzenesulfonyl)-5-ethylsulfonyl-2-(4-fluorophenyl)-1,3-oxazole |
| InChIKey | MVTLATINKNLPEJ-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=C(N=C(O1)C2=CC=C(C=C2)F)S(=O)(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)