Products 924473-59-6
CAS 924473-59-6 appears in our catalog under these names: T56-LIMKi/ 98.61% (existing batch purity), T 5601640, T56-LIMKi, T56-LIMKi 99%, T 5601640, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 25 mg, 100 mg.
3-methyl-N-[3-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]-1,2-oxazole-5-carboxamide (CAS 924473-59-6) is a chemical compound with the molecular formula C19H14F3N3O3 and a molecular weight of 389.3 g/mol. IUPAC name: 3-methyl-N-[3-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]-1,2-oxazole-5-carboxamide. InChIKey: XVOKFRPKSAWELK-UHFFFAOYSA-N.
| Molecular formula | C19H14F3N3O3 |
|---|---|
| Molecular weight | 389.3 g/mol |
| IUPAC name | 3-methyl-N-[3-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]-1,2-oxazole-5-carboxamide |
| InChIKey | XVOKFRPKSAWELK-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1)C(=O)NC2=CC=CC(=C2)C(=O)NC3=CC=CC(=C3)C(F)(F)F |
Computed by PubChem (NCBI)