Products 1334921-03-7
CAS 1334921-03-7 appears in our catalog under these names: TAI-1/ 98.72% (existing batch purity), TAI–1, TAI-1, TAI-1 99%, TAI-1, ≥98%, ≥98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 5 mg.
N-[4-[4-(4-methoxyphenoxy)-2,6-dimethylphenyl]-1,3-thiazol-2-yl]pyridine-4-carboxamide (CAS 1334921-03-7) is a chemical compound with the molecular formula C24H21N3O3S and a molecular weight of 431.5 g/mol. IUPAC name: N-[4-[4-(4-methoxyphenoxy)-2,6-dimethylphenyl]-1,3-thiazol-2-yl]pyridine-4-carboxamide. InChIKey: NBNNDUZYMXBCOX-UHFFFAOYSA-N.
| Molecular formula | C24H21N3O3S |
|---|---|
| Molecular weight | 431.5 g/mol |
| IUPAC name | N-[4-[4-(4-methoxyphenoxy)-2,6-dimethylphenyl]-1,3-thiazol-2-yl]pyridine-4-carboxamide |
| InChIKey | NBNNDUZYMXBCOX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C2=CSC(=N2)NC(=O)C3=CC=NC=C3)C)OC4=CC=C(C=C4)OC |
Computed by PubChem (NCBI)