CAS 1929519-13-0 appears in our catalog under these names: TAK-041/ 99.49% (existing batch purity), TAK–041 , Zelatriazin 98%, TAK-041, 98%, 98%, Zelatriazin, 99.88%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 10mM/1mL.
2-(4-oxo-1,2,3-benzotriazin-3-yl)-N-[(1S)-1-[4-(trifluoromethoxy)phenyl]ethyl]acetamide (CAS 1929519-13-0) is a chemical compound with the molecular formula C18H15F3N4O3 and a molecular weight of 392.3 g/mol. IUPAC name: 2-(4-oxo-1,2,3-benzotriazin-3-yl)-N-[(1S)-1-[4-(trifluoromethoxy)phenyl]ethyl]acetamide. InChIKey: JZGLECLGVQRPPI-NSHDSACASA-N.
| Molecular formula | C18H15F3N4O3 |
|---|---|
| Molecular weight | 392.3 g/mol |
| IUPAC name | 2-(4-oxo-1,2,3-benzotriazin-3-yl)-N-[(1S)-1-[4-(trifluoromethoxy)phenyl]ethyl]acetamide |
| InChIKey | JZGLECLGVQRPPI-NSHDSACASA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)OC(F)(F)F)NC(=O)CN2C(=O)C3=CC=CC=C3N=N2 |
Computed by PubChem (NCBI)