CAS 1820812-16-5 appears in our catalog under these names: TAK-071/ 98.47% (existing batch purity), TAK-071, TAK-071, 98%, 98%, TAK-071, 99.44%. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM/1mL.
4-fluoro-2-[(3S,4S)-4-hydroxyoxan-3-yl]-5-methyl-6-[(4-pyrazol-1-ylphenyl)methyl]-3H-isoindol-1-one (CAS 1820812-16-5) is a chemical compound with the molecular formula C24H24FN3O3 and a molecular weight of 421.5 g/mol. IUPAC name: 4-fluoro-2-[(3S,4S)-4-hydroxyoxan-3-yl]-5-methyl-6-[(4-pyrazol-1-ylphenyl)methyl]-3H-isoindol-1-one. InChIKey: WFSARWQASFQZMG-VXKWHMMOSA-N.
| Molecular formula | C24H24FN3O3 |
|---|---|
| Molecular weight | 421.5 g/mol |
| IUPAC name | 4-fluoro-2-[(3S,4S)-4-hydroxyoxan-3-yl]-5-methyl-6-[(4-pyrazol-1-ylphenyl)methyl]-3H-isoindol-1-one |
| InChIKey | WFSARWQASFQZMG-VXKWHMMOSA-N |
| SMILES | CC1=C(C2=C(C=C1CC3=CC=C(C=C3)N4C=CC=N4)C(=O)N(C2)[C@H]5COCC[C@@H]5O)F |
Computed by PubChem (NCBI)