CAS 1358751-06-0 appears in our catalog under these names: TAK-653/ 99.18% (existing batch purity), TAK–653, Osavampator 99%, 9-(4-(Cyclohexyloxy)phenyl)-7-methyl-3,4-dihydropyrazino[2,1-c][1,2,4]thiadiazine 2,2-dioxide, 98%, 98%, Osavampator, 99.74%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
9-(4-cyclohexyloxyphenyl)-7-methyl-3,4-dihydropyrazino[2,1-c][1,2,4]thiadiazine 2,2-dioxide (CAS 1358751-06-0) is a chemical compound with the molecular formula C19H23N3O3S and a molecular weight of 373.5 g/mol. IUPAC name: 9-(4-cyclohexyloxyphenyl)-7-methyl-3,4-dihydropyrazino[2,1-c][1,2,4]thiadiazine 2,2-dioxide. InChIKey: PXJBHEHFVQVDDS-UHFFFAOYSA-N.
| Molecular formula | C19H23N3O3S |
|---|---|
| Molecular weight | 373.5 g/mol |
| IUPAC name | 9-(4-cyclohexyloxyphenyl)-7-methyl-3,4-dihydropyrazino[2,1-c][1,2,4]thiadiazine 2,2-dioxide |
| InChIKey | PXJBHEHFVQVDDS-UHFFFAOYSA-N |
| SMILES | CC1=CN2CCS(=O)(=O)N=C2C(=N1)C3=CC=C(C=C3)OC4CCCCC4 |
Computed by PubChem (NCBI)