CAS 1257426-19-9 appears in our catalog under these names: TBA-354/ 99.35% (existing batch purity), TBA354, TBA-354, ≥98%, ≥98%, TBA-354, 99.74%, TBA-354 (Standard). Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 10mM (in 1ml dmso).
(6S)-2-nitro-6-[[6-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine (CAS 1257426-19-9) is a chemical compound with the molecular formula C19H15F3N4O5 and a molecular weight of 436.3 g/mol. IUPAC name: (6S)-2-nitro-6-[[6-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine. InChIKey: ZXSGSFMORAILEY-HNNXBMFYSA-N.
| Molecular formula | C19H15F3N4O5 |
|---|---|
| Molecular weight | 436.3 g/mol |
| IUPAC name | (6S)-2-nitro-6-[[6-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
| InChIKey | ZXSGSFMORAILEY-HNNXBMFYSA-N |
| SMILES | C1[C@@H](COC2=NC(=CN21)[N+](=O)[O-])OCC3=CN=C(C=C3)C4=CC=C(C=C4)OC(F)(F)F |
Computed by PubChem (NCBI)