CAS 1393814-38-4 appears in our catalog under these names: TC LPA5 4, TC LPA5 4, TC LPA5 4, 99.69%, TC LPA5 4/ 99.05% (existing batch purity), 5-(3-Chloro-4-cyclohexylphenyl)-1-(3-methoxyphenyl)-1H-pyrazole-3-carboxylic acid. Offered by: TRC, GLPBio, Biosynth, MedChemExpress, TargetMol. Available pack sizes: 500mg, 10mg, 50mg, 25mg, 100mg, 5 mg, 10 mg, 100 mg.
5-(3-chloro-4-cyclohexylphenyl)-1-(3-methoxyphenyl)pyrazole-3-carboxylic acid (CAS 1393814-38-4) is a chemical compound with the molecular formula C23H23ClN2O3 and a molecular weight of 410.9 g/mol. IUPAC name: 5-(3-chloro-4-cyclohexylphenyl)-1-(3-methoxyphenyl)pyrazole-3-carboxylic acid. InChIKey: BNALUYKEGYUHQC-UHFFFAOYSA-N.
| Molecular formula | C23H23ClN2O3 |
|---|---|
| Molecular weight | 410.9 g/mol |
| IUPAC name | 5-(3-chloro-4-cyclohexylphenyl)-1-(3-methoxyphenyl)pyrazole-3-carboxylic acid |
| InChIKey | BNALUYKEGYUHQC-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)N2C(=CC(=N2)C(=O)O)C3=CC(=C(C=C3)C4CCCCC4)Cl |
Computed by PubChem (NCBI)