CAS 1211866-85-1 appears in our catalog under these names: TC-N 1752/ 97.87% (existing batch purity), TC–N 1752, Nav1.7 blocker 52, TC-N 1752 97%, TC-N 1752, 99.67%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
N-[2-methyl-3-[[4-[4-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]acetamide (CAS 1211866-85-1) is a chemical compound with the molecular formula C25H27F3N6O3 and a molecular weight of 516.5 g/mol. IUPAC name: N-[2-methyl-3-[[4-[4-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]acetamide. InChIKey: QLKAFHZJICDACE-UHFFFAOYSA-N.
| Molecular formula | C25H27F3N6O3 |
|---|---|
| Molecular weight | 516.5 g/mol |
| IUPAC name | N-[2-methyl-3-[[4-[4-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]acetamide |
| InChIKey | QLKAFHZJICDACE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1NC(=O)C)NC2=NC(=NC=N2)N3CCC(CC3)OCC4=CC=C(C=C4)OC(F)(F)F |
Computed by PubChem (NCBI)