CAS 1314140-00-5 appears in our catalog under these names: TC-N 22A, TC-N 22A/ 99.84% (existing batch purity), TC–N 22A, TC-N 22A, 98%, 98%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1 mg.
N-pyridin-2-yl-5-thia-3,11,12-triazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine (CAS 1314140-00-5) is a chemical compound with the molecular formula C14H13N5S and a molecular weight of 283.35 g/mol. IUPAC name: N-pyridin-2-yl-5-thia-3,11,12-triazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine. InChIKey: DBISXWCOHGUFSF-UHFFFAOYSA-N.
| Molecular formula | C14H13N5S |
|---|---|
| Molecular weight | 283.35 g/mol |
| IUPAC name | N-pyridin-2-yl-5-thia-3,11,12-triazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine |
| InChIKey | DBISXWCOHGUFSF-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=NN2)C3=C(C1)SC(=N3)NC4=CC=CC=N4 |
Computed by PubChem (NCBI)