cas: 51805-45-9 — see every product listed under this CAS number, including other names
TCEP HCl, 98% (CAS 51805-45-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M02624-100MG |
| cas | 51805-45-9 |
| size | 100mg |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 1g | 112.48 Pln | |
| Fluorochem | 5g | 128.10 Pln | |
| Fluorochem | 10g | 174.96 Pln | |
| Fluorochem | 25g | 206.20 Pln | |
| Fluorochem | 100g | 539.41 Pln | |
| Fluorochem | 500g | 2283.59 Pln | |
| Fluorochem | 1kg | 3876.78 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrochloride (CAS 51805-45-9) is a chemical compound with the molecular formula C9H16ClO6P and a molecular weight of 286.64 g/mol. IUPAC name: 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrochloride. InChIKey: PBVAJRFEEOIAGW-UHFFFAOYSA-N.
| Molecular formula | C9H16ClO6P |
|---|---|
| Molecular weight | 286.64 g/mol |
| IUPAC name | 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrochloride |
| InChIKey | PBVAJRFEEOIAGW-UHFFFAOYSA-N |
| SMILES | C(CP(CCC(=O)O)CCC(=O)O)C(=O)O.Cl |
Computed by PubChem (NCBI)