CAS 51805-45-9 appears in our catalog under these names: TCEP Hydrochloride, >95% (HPLC), TCEP Hydrochloride (0.5M in water), TCEP hydrochloride, TCEP hydrochloride/ 99.56% (existing batch purity), TCEP*HCl. Offered by: TRC, GLPBio, TargetMol, Iris Biotech, Thermo Scientific (Alfa Aesar). Available pack sizes: 10g, 1g, 25g, 10ml, 1ml, 2g, 50g, 100mg.
3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrochloride (CAS 51805-45-9) is a chemical compound with the molecular formula C9H16ClO6P and a molecular weight of 286.64 g/mol. IUPAC name: 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrochloride. InChIKey: PBVAJRFEEOIAGW-UHFFFAOYSA-N.
| Molecular formula | C9H16ClO6P |
|---|---|
| Molecular weight | 286.64 g/mol |
| IUPAC name | 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrochloride |
| InChIKey | PBVAJRFEEOIAGW-UHFFFAOYSA-N |
| SMILES | C(CP(CCC(=O)O)CCC(=O)O)C(=O)O.Cl |
Computed by PubChem (NCBI)