CAS 76150-91-9 appears in our catalog under these names: TCPOBOP, TCPOBOP/ 99.7% (existing batch purity), TCPOBOP, >95.0%(HPLC), TCPOBOP 1PC X 25MG, TCPOBOP, 95.0%, 95.0%. Offered by: TRC, TargetMol, GLPBio, Biosynth, TCI. Available pack sizes: 100mg, 5mg, 10mg, 25mg, 50mg, 200mg, 250mg, 1g.
3,5-dichloro-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]pyridine (CAS 76150-91-9) is a chemical compound with the molecular formula C16H8Cl4N2O2 and a molecular weight of 402.1 g/mol. IUPAC name: 3,5-dichloro-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]pyridine. InChIKey: BAFKRPOFIYPKBQ-UHFFFAOYSA-N.
| Molecular formula | C16H8Cl4N2O2 |
|---|---|
| Molecular weight | 402.1 g/mol |
| IUPAC name | 3,5-dichloro-2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]pyridine |
| InChIKey | BAFKRPOFIYPKBQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=C(C=C(C=N2)Cl)Cl)OC3=C(C=C(C=N3)Cl)Cl |
Computed by PubChem (NCBI)