CAS 2810887-45-5 appears in our catalog under these names: TDI–10229, TDI-10229/ 97.77% (existing batch purity), TDI-10229, TDI-10229, 99.84%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 200mg.
4-(4-benzyl-1,5-dimethylpyrazol-3-yl)-6-chloropyrimidin-2-amine (CAS 2810887-45-5) is a chemical compound with the molecular formula C16H16ClN5 and a molecular weight of 313.78 g/mol. IUPAC name: 4-(4-benzyl-1,5-dimethylpyrazol-3-yl)-6-chloropyrimidin-2-amine. InChIKey: VSMTYSWGHKYXOF-UHFFFAOYSA-N.
| Molecular formula | C16H16ClN5 |
|---|---|
| Molecular weight | 313.78 g/mol |
| IUPAC name | 4-(4-benzyl-1,5-dimethylpyrazol-3-yl)-6-chloropyrimidin-2-amine |
| InChIKey | VSMTYSWGHKYXOF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C)C2=CC(=NC(=N2)N)Cl)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)