cas: 474809-21-7 — see every product listed under this CAS number, including other names
TERT-BUTYL ((2-AMINOPYRIDIN-4-YL)METHYL)CARBAMATE, 95%, 95% (CAS 474809-21-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DKUZ-100mg |
| cas | 474809-21-7 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 434.00 Pln | |
| Chemat | 500mg | 669.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(2-amino-4-pyridinyl)methyl]carbamate (CAS 474809-21-7) is a chemical compound with the molecular formula C11H17N3O2 and a molecular weight of 223.27 g/mol. IUPAC name: tert-butyl N-[(2-amino-4-pyridinyl)methyl]carbamate. InChIKey: JTKROKSMVFTCKQ-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O2 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | tert-butyl N-[(2-amino-4-pyridinyl)methyl]carbamate |
| InChIKey | JTKROKSMVFTCKQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC(=NC=C1)N |
Computed by PubChem (NCBI)