cas: 1379322-06-1 — see every product listed under this CAS number, including other names
TERT-BUTYL ((3-AMINOOXETAN-3-YL)METHYL)CARBAMATE, 97% (CAS 1379322-06-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F332397-100MG |
| cas | 1379322-06-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 529.00 Pln | |
| Fluorochem | 250mg | 820.56 Pln | |
| Fluorochem | 1g | 2096.15 Pln | |
| Fluorochem | 5g | 8125.28 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl N-[(3-aminooxetan-3-yl)methyl]carbamate (CAS 1379322-06-1) is a chemical compound with the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. IUPAC name: tert-butyl N-[(3-aminooxetan-3-yl)methyl]carbamate. InChIKey: JJEGJQVVIXYASG-UHFFFAOYSA-N.
| Molecular formula | C9H18N2O3 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | tert-butyl N-[(3-aminooxetan-3-yl)methyl]carbamate |
| InChIKey | JJEGJQVVIXYASG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1(COC1)N |
Computed by PubChem (NCBI)