cas: 1476776-55-2 — see every product listed under this CAS number, including other names
TERT-BUTYL (3S)-3-(4-BROMOPHENYL)-PIPERIDINE-1-CARBOXYLATE, 98% (CAS 1476776-55-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F504537-250MG |
| cas | 1476776-55-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 409.25 Pln | |
| Fluorochem | 500mg | 440.49 Pln | |
| Fluorochem | 1g | 487.35 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (3S)-3-(4-bromophenyl)piperidine-1-carboxylate (CAS 1476776-55-2) is a chemical compound with the molecular formula C16H22BrNO2 and a molecular weight of 340.25 g/mol. IUPAC name: tert-butyl (3S)-3-(4-bromophenyl)piperidine-1-carboxylate. InChIKey: WRSHWNCUNYWQBB-CYBMUJFWSA-N.
| Molecular formula | C16H22BrNO2 |
|---|---|
| Molecular weight | 340.25 g/mol |
| IUPAC name | tert-butyl (3S)-3-(4-bromophenyl)piperidine-1-carboxylate |
| InChIKey | WRSHWNCUNYWQBB-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)